C12H14BrFN2O — CID 113452141
N-(3-bromo-4-fluorophenyl)-2-pyrrolidin-3-ylacetamide (PubChem CID 113452141) has the molecular formula C12H14BrFN2O and a molecular weight of 301.16 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-2-pyrrolidin-3-ylacetamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-2-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 113452141 |
| Molecular Formula | C12H14BrFN2O |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-2-pyrrolidin-3-ylacetamide |
| SMILES | O=C(CC1CCNC1)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H14BrFN2O/c13-10-6-9(1-2-11(10)14)16-12(17)5-8-3-4-15-7-8/h1-2,6,8,15H,3-5,7H2,(H,16,17) |
| InChIKey | NNXFUYNQJGRFER-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |