C13H17IN2O — CID 62676298
N-(2-iodophenyl)-2-piperidin-3-ylacetamide (PubChem CID 62676298) has the molecular formula C13H17IN2O and a molecular weight of 344.20 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-piperidin-3-ylacetamide.
| Compound Name | N-(2-iodophenyl)-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 62676298 |
| Molecular Formula | C13H17IN2O |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-(2-iodophenyl)-2-piperidin-3-ylacetamide |
| SMILES | O=C(CC1CCCNC1)Nc1ccccc1I |
| InChI | InChI=1S/C13H17IN2O/c14-11-5-1-2-6-12(11)16-13(17)8-10-4-3-7-15-9-10/h1-2,5-6,10,15H,3-4,7-9H2,(H,16,17) |
| InChIKey | ADQVGUUZHQNCGB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|