C15H19IN2O — CID 79606850
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-iodophenyl)acetamide (PubChem CID 79606850) has the molecular formula C15H19IN2O and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-iodophenyl)acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 79606850 |
| Molecular Formula | C15H19IN2O |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-iodophenyl)acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)Nc1ccccc1I |
| InChI | InChI=1S/C15H19IN2O/c16-13-3-1-2-4-14(13)18-15(19)9-10-7-11-5-6-12(8-10)17-11/h1-4,10-12,17H,5-9H2,(H,18,19) |
| InChIKey | OYJUEHZKGQFLKU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|