C20H31Cl2N3O — CID 119828036
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride (PubChem CID 119828036) has the molecular formula C20H31Cl2N3O and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119828036 |
| Molecular Formula | C20H31Cl2N3O |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-piperidin-1-ylphenyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CC2CCC(C1)N2)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C20H29N3O.2ClH/c24-20(14-15-12-16-8-9-17(13-15)21-16)22-18-6-2-3-7-19(18)23-10-4-1-5-11-23;;/h2-3,6-7,15-17,21H,1,4-5,8-14H2,(H,22,24);2*1H |
| InChIKey | ZWQNPNWQZLVTQI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |