C8H5BrF3NO — CID 63678606
2-bromo-N-(2,4,5-trifluorophenyl)acetamide (PubChem CID 63678606) has the molecular formula C8H5BrF3NO and a molecular weight of 268.03 g/mol. Its IUPAC name is 2-bromo-N-(2,4,5-trifluorophenyl)acetamide.
| Compound Name | 2-bromo-N-(2,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 63678606 |
| Molecular Formula | C8H5BrF3NO |
| Molecular Weight | 268.03 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 2-bromo-N-(2,4,5-trifluorophenyl)acetamide |
| SMILES | O=C(CBr)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C8H5BrF3NO/c9-3-8(14)13-7-2-5(11)4(10)1-6(7)12/h1-2H,3H2,(H,13,14) |
| InChIKey | AGSXTWRBCUCOGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.03 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|