C7H4F3NO2 — CID 89413895
(2,4,5-trifluorophenyl)carbamic acid (PubChem CID 89413895) has the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. Its IUPAC name is (2,4,5-trifluorophenyl)carbamic acid.
| Compound Name | (2,4,5-trifluorophenyl)carbamic acid |
|---|---|
| PubChem CID | 89413895 |
| Molecular Formula | C7H4F3NO2 |
| Molecular Weight | 191.11 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | (2,4,5-trifluorophenyl)carbamic acid |
| SMILES | O=C(O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C7H4F3NO2/c8-3-1-5(10)6(2-4(3)9)11-7(12)13/h1-2,11H,(H,12,13) |
| InChIKey | XAWXCRLXEKOUSO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|