C14H8F6N4O2 — CID 138620273
1-N',2-N'-bis(2,4,5-trifluorophenyl)ethanedihydrazide (PubChem CID 138620273) has the molecular formula C14H8F6N4O2 and a molecular weight of 378.23 g/mol. Its IUPAC name is 1-N',2-N'-bis(2,4,5-trifluorophenyl)ethanedihydrazide.
| Compound Name | 1-N',2-N'-bis(2,4,5-trifluorophenyl)ethanedihydrazide |
|---|---|
| PubChem CID | 138620273 |
| Molecular Formula | C14H8F6N4O2 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-N',2-N'-bis(2,4,5-trifluorophenyl)ethanedihydrazide |
| SMILES | O=C(NNc1cc(F)c(F)cc1F)C(=O)NNc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H8F6N4O2/c15-5-1-9(19)11(3-7(5)17)21-23-13(25)14(26)24-22-12-4-8(18)6(16)2-10(12)20/h1-4,21-22H,(H,23,25)(H,24,26) |
| InChIKey | SJAOMJSOYFEKJN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|