C11H13F3N2O — CID 115613885
1,1-diethyl-3-(2,4,5-trifluorophenyl)urea (PubChem CID 115613885) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 1,1-diethyl-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1,1-diethyl-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 115613885 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,1-diethyl-3-(2,4,5-trifluorophenyl)urea |
| SMILES | CCN(CC)C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H13F3N2O/c1-3-16(4-2)11(17)15-10-6-8(13)7(12)5-9(10)14/h5-6H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | XICJSUQHBJFLSF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|