C13H16F2N2O4 — CID 61425390
2,4-difluoro-5-[[2-hydroxyethyl(propyl)carbamoyl]amino]benzoic acid (PubChem CID 61425390) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,4-difluoro-5-[[2-hydroxyethyl(propyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[[2-hydroxyethyl(propyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61425390 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2,4-difluoro-5-[[2-hydroxyethyl(propyl)carbamoyl]amino]benzoic acid |
| SMILES | CCCN(CCO)C(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C13H16F2N2O4/c1-2-3-17(4-5-18)13(21)16-11-6-8(12(19)20)9(14)7-10(11)15/h6-7,18H,2-5H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | GFALNJGUFSLVHR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |