C9H8F3NO — CID 63372836
N-(2,4,5-trifluorophenyl)propanamide (PubChem CID 63372836) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)propanamide.
| Compound Name | N-(2,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 63372836 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)propanamide |
| SMILES | CCC(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H8F3NO/c1-2-9(14)13-8-4-6(11)5(10)3-7(8)12/h3-4H,2H2,1H3,(H,13,14) |
| InChIKey | IIOHTGMPCBWHHA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|