C11H14ClF3N2O2 — CID 120588070
4-amino-3-methoxy-N-(2,4,5-trifluorophenyl)butanamide;hydrochloride (PubChem CID 120588070) has the molecular formula C11H14ClF3N2O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2,4,5-trifluorophenyl)butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-(2,4,5-trifluorophenyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120588070 |
| Molecular Formula | C11H14ClF3N2O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-amino-3-methoxy-N-(2,4,5-trifluorophenyl)butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C11H13F3N2O2.ClH/c1-18-6(5-15)2-11(17)16-10-4-8(13)7(12)3-9(10)14;/h3-4,6H,2,5,15H2,1H3,(H,16,17);1H |
| InChIKey | GTKCWSLTGFSCHQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|