C14H18F2N2O3 — CID 81070163
methyl 5-[3-(aminomethyl)pentanoylamino]-2,4-difluorobenzoate (PubChem CID 81070163) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 5-[3-(aminomethyl)pentanoylamino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[3-(aminomethyl)pentanoylamino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 81070163 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | methyl 5-[3-(aminomethyl)pentanoylamino]-2,4-difluorobenzoate |
| SMILES | CCC(CN)CC(=O)Nc1cc(C(=O)OC)c(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O3/c1-3-8(7-17)4-13(19)18-12-5-9(14(20)21-2)10(15)6-11(12)16/h5-6,8H,3-4,7,17H2,1-2H3,(H,18,19) |
| InChIKey | QDKPONIDUCCYQF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |