C13H17ClF3N3O3 — CID 120586978
4-amino-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide;hydrochloride (PubChem CID 120586978) has the molecular formula C13H17ClF3N3O3 and a molecular weight of 355.74 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120586978 |
| Molecular Formula | C13H17ClF3N3O3 |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCC(=O)Nc1ccc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C13H16F3N3O3.ClH/c1-22-7(5-17)4-10(20)18-6-11(21)19-9-3-2-8(14)12(15)13(9)16;/h2-3,7H,4-6,17H2,1H3,(H,18,20)(H,19,21);1H |
| InChIKey | MTDBWRDOFORQCQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|