C10H12F3IN4O — CID 110913519
2-[(N'-methylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 110913519) has the molecular formula C10H12F3IN4O and a molecular weight of 388.13 g/mol. Its IUPAC name is 2-[(N'-methylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[(N'-methylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110913519 |
| Molecular Formula | C10H12F3IN4O |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 2-[(N'-methylcarbamimidoyl)amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(\N)NCC(=O)Nc1ccc(F)c(F)c1F.I |
| InChI | InChI=1S/C10H11F3N4O.HI/c1-15-10(14)16-4-7(18)17-6-3-2-5(11)8(12)9(6)13;/h2-3H,4H2,1H3,(H,17,18)(H3,14,15,16);1H |
| InChIKey | IQZIUQMPFFIZBF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|