C19H22F3IN4O3 — CID 111200479
2-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111200479) has the molecular formula C19H22F3IN4O3 and a molecular weight of 538.31 g/mol. Its IUPAC name is 2-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111200479 |
| Molecular Formula | C19H22F3IN4O3 |
| Molecular Weight | 538.31 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 2-[[N-[(3,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H21F3N4O3.HI/c1-23-19(24-9-11-4-7-14(28-2)15(8-11)29-3)25-10-16(27)26-13-6-5-12(20)17(21)18(13)22;/h4-8H,9-10H2,1-3H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | CKYQXEVUKOLGLU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|