C15H16F3IN4OS — CID 111940908
2-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111940908) has the molecular formula C15H16F3IN4OS and a molecular weight of 484.29 g/mol. Its IUPAC name is 2-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111940908 |
| Molecular Formula | C15H16F3IN4OS |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 2-[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCc1ccsc1.I |
| InChI | InChI=1S/C15H15F3N4OS.HI/c1-19-15(20-6-9-4-5-24-8-9)21-7-12(23)22-11-3-2-10(16)13(17)14(11)18;/h2-5,8H,6-7H2,1H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | QPBPRACDMXMQNR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|