C18H19F4IN4O — CID 111361100
2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111361100) has the molecular formula C18H19F4IN4O and a molecular weight of 510.27 g/mol. Its IUPAC name is 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111361100 |
| Molecular Formula | C18H19F4IN4O |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCC(=O)Nc1ccc(F)c(F)c1F.I |
| InChI | InChI=1S/C18H18F4N4O.HI/c1-23-18(24-9-8-11-4-2-3-5-12(11)19)25-10-15(27)26-14-7-6-13(20)16(21)17(14)22;/h2-7H,8-10H2,1H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | ZHWJADFRFIYWCU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|