C15H22F3IN4O2 — CID 111222006
2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111222006) has the molecular formula C15H22F3IN4O2 and a molecular weight of 474.27 g/mol. Its IUPAC name is 2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111222006 |
| Molecular Formula | C15H22F3IN4O2 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NCC(=O)Nc1ccc(F)c(F)c1F.I |
| InChI | InChI=1S/C15H21F3N4O2.HI/c1-3-24-8-4-7-20-15(19-2)21-9-12(23)22-11-6-5-10(16)13(17)14(11)18;/h5-6H,3-4,7-9H2,1-2H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | BJMKSJIQCPUOIQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|