C14H20F3IN4O2 — CID 111896632
2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111896632) has the molecular formula C14H20F3IN4O2 and a molecular weight of 460.24 g/mol. Its IUPAC name is 2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111896632 |
| Molecular Formula | C14H20F3IN4O2 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 2-[[N-(2-ethoxyethyl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCOCCN/C(=N\C)NCC(=O)Nc1ccc(F)c(F)c1F.I |
| InChI | InChI=1S/C14H19F3N4O2.HI/c1-3-23-7-6-19-14(18-2)20-8-11(22)21-10-5-4-9(15)12(16)13(10)17;/h4-5H,3,6-8H2,1-2H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | WVZRASNUYWSTMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|