C18H18F4N4O — CID 111845455
2-[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111845455) has the molecular formula C18H18F4N4O and a molecular weight of 382.36 g/mol. Its IUPAC name is 2-[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111845455 |
| Molecular Formula | C18H18F4N4O |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[[N-[(3-fluoro-4-methylphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C18H18F4N4O/c1-10-3-4-11(7-13(10)20)8-24-18(23-2)25-9-15(27)26-14-6-5-12(19)16(21)17(14)22/h3-7H,8-9H2,1-2H3,(H,26,27)(H2,23,24,25) |
| InChIKey | HBYGFGHWCHVTAY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|