C14H17F3IN7O — CID 111705034
2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111705034) has the molecular formula C14H17F3IN7O and a molecular weight of 483.24 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111705034 |
| Molecular Formula | C14H17F3IN7O |
| Molecular Weight | 483.24 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCc1ncnn1C.I |
| InChI | InChI=1S/C14H16F3N7O.HI/c1-18-14(19-5-10-21-7-22-24(10)2)20-6-11(25)23-9-4-3-8(15)12(16)13(9)17;/h3-4,7H,5-6H2,1-2H3,(H,23,25)(H2,18,19,20);1H |
| InChIKey | QQZFTIULOMFTQL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|