C12H15F3N2OS — CID 115570464
1-(3-ethoxypropyl)-3-(2,3,4-trifluorophenyl)thiourea (PubChem CID 115570464) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(2,3,4-trifluorophenyl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(2,3,4-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 115570464 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(2,3,4-trifluorophenyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H15F3N2OS/c1-2-18-7-3-6-16-12(19)17-9-5-4-8(13)10(14)11(9)15/h4-5H,2-3,6-7H2,1H3,(H2,16,17,19) |
| InChIKey | UYDOUTYNGHBKRM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|