C10H16N4OS — CID 100559977
1-(3-ethoxypropyl)-3-pyrimidin-2-ylthiourea (PubChem CID 100559977) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-pyrimidin-2-ylthiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-pyrimidin-2-ylthiourea |
|---|---|
| PubChem CID | 100559977 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-pyrimidin-2-ylthiourea |
| SMILES | CCOCCCNC(=S)Nc1ncccn1 |
| InChI | InChI=1S/C10H16N4OS/c1-2-15-8-4-7-13-10(16)14-9-11-5-3-6-12-9/h3,5-6H,2,4,7-8H2,1H3,(H2,11,12,13,14,16) |
| InChIKey | ILPYLBUMTKVYAN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|