C12H22N4OS — CID 19574620
1-(3-ethoxypropyl)-3-(3-pyrazol-1-ylpropyl)thiourea (PubChem CID 19574620) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(3-pyrazol-1-ylpropyl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(3-pyrazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 19574620 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(3-pyrazol-1-ylpropyl)thiourea |
| SMILES | CCOCCCNC(=S)NCCCn1cccn1 |
| InChI | InChI=1S/C12H22N4OS/c1-2-17-11-5-7-14-12(18)13-6-3-9-16-10-4-8-15-16/h4,8,10H,2-3,5-7,9,11H2,1H3,(H2,13,14,18) |
| InChIKey | QCWDSAOEPIIJGF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|