C11H20N4OS — CID 115590234
1-(3-ethoxypropyl)-3-(1-ethylpyrazol-4-yl)thiourea (PubChem CID 115590234) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(1-ethylpyrazol-4-yl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(1-ethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 115590234 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(1-ethylpyrazol-4-yl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1cnn(CC)c1 |
| InChI | InChI=1S/C11H20N4OS/c1-3-15-9-10(8-13-15)14-11(17)12-6-5-7-16-4-2/h8-9H,3-7H2,1-2H3,(H2,12,14,17) |
| InChIKey | RCENOOSYZVIPFU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|