C11H17F3N4OS — CID 19445996
1-butyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea (PubChem CID 19445996) has the molecular formula C11H17F3N4OS and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-butyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-butyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445996 |
| Molecular Formula | C11H17F3N4OS |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-butyl-3-[1-(2,2,2-trifluoroethoxymethyl)pyrazol-4-yl]thiourea |
| SMILES | CCCCNC(=S)Nc1cnn(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H17F3N4OS/c1-2-3-4-15-10(20)17-9-5-16-18(6-9)8-19-7-11(12,13)14/h5-6H,2-4,7-8H2,1H3,(H2,15,17,20) |
| InChIKey | JIPAQVDFCFFPSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|