C17H21F3N4OS — CID 19344331
1-(3-ethoxypropyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea (PubChem CID 19344331) has the molecular formula C17H21F3N4OS and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344331 |
| Molecular Formula | C17H21F3N4OS |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
| SMILES | CCOCCCNC(=S)Nc1cnn(Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H21F3N4OS/c1-2-25-8-4-7-21-16(26)23-15-10-22-24(12-15)11-13-5-3-6-14(9-13)17(18,19)20/h3,5-6,9-10,12H,2,4,7-8,11H2,1H3,(H2,21,23,26) |
| InChIKey | GVIJQOVCFGXCLY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|