C17H15F3N4OS — CID 19344316
1-(furan-2-ylmethyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea (PubChem CID 19344316) has the molecular formula C17H15F3N4OS and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344316 |
| Molecular Formula | C17H15F3N4OS |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
| SMILES | FC(F)(F)c1cccc(Cn2cc(NC(=S)NCc3ccco3)cn2)c1 |
| InChI | InChI=1S/C17H15F3N4OS/c18-17(19,20)13-4-1-3-12(7-13)10-24-11-14(8-22-24)23-16(26)21-9-15-5-2-6-25-15/h1-8,11H,9-10H2,(H2,21,23,26) |
| InChIKey | NZNLMUYPLCVELJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|