C17H14F3N3O2 — CID 35761745
2-methyl-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-3-carboxamide (PubChem CID 35761745) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-methyl-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 35761745 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-methyl-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]furan-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1cnn(Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H14F3N3O2/c1-11-15(5-6-25-11)16(24)22-14-8-21-23(10-14)9-12-3-2-4-13(7-12)17(18,19)20/h2-8,10H,9H2,1H3,(H,22,24) |
| InChIKey | GJZGPQCBUSWMAY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |