C18H18F3N5O — CID 19555897
3-(3-methylpyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide (PubChem CID 19555897) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-(3-methylpyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide.
| Compound Name | 3-(3-methylpyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 19555897 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-(3-methylpyrazol-1-yl)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]propanamide |
| SMILES | Cc1ccn(CCC(=O)Nc2cnn(Cc3cccc(C(F)(F)F)c3)c2)n1 |
| InChI | InChI=1S/C18H18F3N5O/c1-13-5-7-25(24-13)8-6-17(27)23-16-10-22-26(12-16)11-14-3-2-4-15(9-14)18(19,20)21/h2-5,7,9-10,12H,6,8,11H2,1H3,(H,23,27) |
| InChIKey | HRKNSYZHNGOKPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |