C15H17F3N4S — CID 19344336
1-propyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea (PubChem CID 19344336) has the molecular formula C15H17F3N4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-propyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-propyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344336 |
| Molecular Formula | C15H17F3N4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-propyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]thiourea |
| SMILES | CCCNC(=S)Nc1cnn(Cc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H17F3N4S/c1-2-6-19-14(23)21-13-8-20-22(10-13)9-11-4-3-5-12(7-11)15(16,17)18/h3-5,7-8,10H,2,6,9H2,1H3,(H2,19,21,23) |
| InChIKey | BSQKWLJNHNJPSW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|