C18H14ClF3N4S — CID 19676751
1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 19676751) has the molecular formula C18H14ClF3N4S and a molecular weight of 410.85 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19676751 |
| Molecular Formula | C18H14ClF3N4S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)Nc2cnn(Cc3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C18H14ClF3N4S/c19-14-6-4-12(5-7-14)10-26-11-16(9-23-26)25-17(27)24-15-3-1-2-13(8-15)18(20,21)22/h1-9,11H,10H2,(H2,24,25,27) |
| InChIKey | WOIUNTLVYJGQMD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|