C17H14Cl2N4S — CID 19344144
1-(3-chlorophenyl)-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344144) has the molecular formula C17H14Cl2N4S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344144 |
| Molecular Formula | C17H14Cl2N4S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | S=C(Nc1cccc(Cl)c1)Nc1cnn(Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H14Cl2N4S/c18-13-4-1-3-12(7-13)10-23-11-16(9-20-23)22-17(24)21-15-6-2-5-14(19)8-15/h1-9,11H,10H2,(H2,21,22,24) |
| InChIKey | WUTJNKCYIJXKCW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|