C16H15BrN4O2S — CID 19445548
1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 19445548) has the molecular formula C16H15BrN4O2S and a molecular weight of 407.29 g/mol. Its IUPAC name is 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19445548 |
| Molecular Formula | C16H15BrN4O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccco1)Nc1cnn(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H15BrN4O2S/c17-12-3-5-14(6-4-12)23-11-21-10-13(8-19-21)20-16(24)18-9-15-2-1-7-22-15/h1-8,10H,9,11H2,(H2,18,20,24) |
| InChIKey | APROYSIXRBENCJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|