C17H13BrCl2N4OS — CID 19445585
1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 19445585) has the molecular formula C17H13BrCl2N4OS and a molecular weight of 472.20 g/mol. Its IUPAC name is 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 19445585 |
| Molecular Formula | C17H13BrCl2N4OS |
| Molecular Weight | 472.20 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)Nc1cnn(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H13BrCl2N4OS/c18-11-1-4-14(5-2-11)25-10-24-9-13(8-21-24)23-17(26)22-12-3-6-15(19)16(20)7-12/h1-9H,10H2,(H2,22,23,26) |
| InChIKey | RSPLUZMZHSVFMZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.20 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|