C23H21BrCl2N6OS — CID 19445582
1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19445582) has the molecular formula C23H21BrCl2N6OS and a molecular weight of 580.34 g/mol. Its IUPAC name is 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445582 |
| Molecular Formula | C23H21BrCl2N6OS |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | 1-[1-[(4-bromophenoxy)methyl]pyrazol-4-yl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=S)Nc1cnn(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H21BrCl2N6OS/c1-14-22(15(2)32(30-14)11-16-3-6-18(25)9-21(16)26)29-23(34)28-19-10-27-31(12-19)13-33-20-7-4-17(24)5-8-20/h3-10,12H,11,13H2,1-2H3,(H2,28,29,34) |
| InChIKey | OJRABYFQSAFFTE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|