C23H23ClN6S — CID 19342659
1-(1-benzylpyrazol-4-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19342659) has the molecular formula C23H23ClN6S and a molecular weight of 451.00 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342659 |
| Molecular Formula | C23H23ClN6S |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1NC(=S)Nc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H23ClN6S/c1-16-22(17(2)30(28-16)14-19-10-6-7-11-21(19)24)27-23(31)26-20-12-25-29(15-20)13-18-8-4-3-5-9-18/h3-12,15H,13-14H2,1-2H3,(H2,26,27,31) |
| InChIKey | XYKYKLAPFMDPIE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|