C21H16Cl2N4S — CID 19343204
1-(3,4-dichlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea (PubChem CID 19343204) has the molecular formula C21H16Cl2N4S and a molecular weight of 427.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343204 |
| Molecular Formula | C21H16Cl2N4S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[1-(naphthalen-1-ylmethyl)pyrazol-4-yl]thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)Nc1cnn(Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H16Cl2N4S/c22-19-9-8-16(10-20(19)23)25-21(28)26-17-11-24-27(13-17)12-15-6-3-5-14-4-1-2-7-18(14)15/h1-11,13H,12H2,(H2,25,26,28) |
| InChIKey | ARLDSWQDJKFDTK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|