C23H20N4O2S — CID 19344638
methyl 2-[[4-(naphthalen-1-ylcarbamothioylamino)pyrazol-1-yl]methyl]benzoate (PubChem CID 19344638) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is methyl 2-[[4-(naphthalen-1-ylcarbamothioylamino)pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-(naphthalen-1-ylcarbamothioylamino)pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19344638 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | methyl 2-[[4-(naphthalen-1-ylcarbamothioylamino)pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cc(NC(=S)Nc2cccc3ccccc23)cn1 |
| InChI | InChI=1S/C23H20N4O2S/c1-29-22(28)20-11-5-3-8-17(20)14-27-15-18(13-24-27)25-23(30)26-21-12-6-9-16-7-2-4-10-19(16)21/h2-13,15H,14H2,1H3,(H2,25,26,30) |
| InChIKey | JZHLIWVQWFUJGV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|