C21H22N4O3S — CID 19344655
methyl 2-[[4-[(2-ethoxyphenyl)carbamothioylamino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19344655) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 2-[[4-[(2-ethoxyphenyl)carbamothioylamino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[(2-ethoxyphenyl)carbamothioylamino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19344655 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | methyl 2-[[4-[(2-ethoxyphenyl)carbamothioylamino]pyrazol-1-yl]methyl]benzoate |
| SMILES | CCOc1ccccc1NC(=S)Nc1cnn(Cc2ccccc2C(=O)OC)c1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-28-19-11-7-6-10-18(19)24-21(29)23-16-12-22-25(14-16)13-15-8-4-5-9-17(15)20(26)27-2/h4-12,14H,3,13H2,1-2H3,(H2,23,24,29) |
| InChIKey | YYORILAEMKUOHT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|