C19H18Cl2N4OS — CID 19343036
1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-(2-ethoxyphenyl)thiourea (PubChem CID 19343036) has the molecular formula C19H18Cl2N4OS and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-(2-ethoxyphenyl)thiourea.
| Compound Name | 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-(2-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19343036 |
| Molecular Formula | C19H18Cl2N4OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-(2-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)Nc1cnn(Cc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N4OS/c1-2-26-18-9-4-3-8-17(18)24-19(27)23-13-10-22-25(11-13)12-14-15(20)6-5-7-16(14)21/h3-11H,2,12H2,1H3,(H2,23,24,27) |
| InChIKey | DHKGYCIZHAFLOZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|