C18H14ClF3N4OS — CID 19343917
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[2-(difluoromethoxy)phenyl]thiourea (PubChem CID 19343917) has the molecular formula C18H14ClF3N4OS and a molecular weight of 426.85 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[2-(difluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[2-(difluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 19343917 |
| Molecular Formula | C18H14ClF3N4OS |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-4-yl]-3-[2-(difluoromethoxy)phenyl]thiourea |
| SMILES | Fc1cccc(Cl)c1Cn1cc(NC(=S)Nc2ccccc2OC(F)F)cn1 |
| InChI | InChI=1S/C18H14ClF3N4OS/c19-13-4-3-5-14(20)12(13)10-26-9-11(8-23-26)24-18(28)25-15-6-1-2-7-16(15)27-17(21)22/h1-9,17H,10H2,(H2,24,25,28) |
| InChIKey | SGTXEOMLCKBKAP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|