C25H26ClFN6O2S — CID 19344223
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344223) has the molecular formula C25H26ClFN6O2S and a molecular weight of 529.04 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344223 |
| Molecular Formula | C25H26ClFN6O2S |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCOc1ccc(Cn2cc(NC(=S)Nc3ccn(Cc4c(F)cccc4Cl)n3)cn2)cc1OCC |
| InChI | InChI=1S/C25H26ClFN6O2S/c1-3-34-22-9-8-17(12-23(22)35-4-2)14-33-15-18(13-28-33)29-25(36)30-24-10-11-32(31-24)16-19-20(26)6-5-7-21(19)27/h5-13,15H,3-4,14,16H2,1-2H3,(H2,29,30,31,36) |
| InChIKey | PWJBZVBGRJYCAQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|