C25H27FN6O2S — CID 19344215
1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19344215) has the molecular formula C25H27FN6O2S and a molecular weight of 494.60 g/mol. Its IUPAC name is 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19344215 |
| Molecular Formula | C25H27FN6O2S |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[1-[(3,4-diethoxyphenyl)methyl]pyrazol-4-yl]-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | CCOc1ccc(Cn2cc(NC(=S)Nc3ccn(Cc4ccccc4F)n3)cn2)cc1OCC |
| InChI | InChI=1S/C25H27FN6O2S/c1-3-33-22-10-9-18(13-23(22)34-4-2)15-32-17-20(14-27-32)28-25(35)29-24-11-12-31(30-24)16-19-7-5-6-8-21(19)26/h5-14,17H,3-4,15-16H2,1-2H3,(H2,28,29,30,35) |
| InChIKey | ZJURHXWFQNRDHW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|