C21H18BrClN6S — CID 19343480
1-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19343480) has the molecular formula C21H18BrClN6S and a molecular weight of 501.84 g/mol. Its IUPAC name is 1-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19343480 |
| Molecular Formula | C21H18BrClN6S |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | 1-[1-[(4-bromophenyl)methyl]pyrazol-4-yl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | S=C(Nc1cnn(Cc2ccc(Br)cc2)c1)Nc1ccn(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C21H18BrClN6S/c22-17-7-5-15(6-8-17)12-29-14-18(11-24-29)25-21(30)26-20-9-10-28(27-20)13-16-3-1-2-4-19(16)23/h1-11,14H,12-13H2,(H2,25,26,27,30) |
| InChIKey | RKVRRBGCFKJJIP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|