C21H16Cl3FN6S — CID 19395197
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19395197) has the molecular formula C21H16Cl3FN6S and a molecular weight of 509.83 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19395197 |
| Molecular Formula | C21H16Cl3FN6S |
| Molecular Weight | 509.83 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1cccc(Cl)c1Cn1ccc(NC(=S)Nc2cnn(Cc3ccc(Cl)cc3Cl)c2)n1 |
| InChI | InChI=1S/C21H16Cl3FN6S/c22-14-5-4-13(18(24)8-14)10-31-11-15(9-26-31)27-21(32)28-20-6-7-30(29-20)12-16-17(23)2-1-3-19(16)25/h1-9,11H,10,12H2,(H2,27,28,29,32) |
| InChIKey | LOLJFJZWWKGMOG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.83 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|