C21H14Cl2F4N6S — CID 19395364
1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19395364) has the molecular formula C21H14Cl2F4N6S and a molecular weight of 529.35 g/mol. Its IUPAC name is 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19395364 |
| Molecular Formula | C21H14Cl2F4N6S |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 1-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Fc1cc(F)c(F)c(Cn2ccc(NC(=S)Nc3cnn(Cc4ccc(Cl)cc4Cl)c3)n2)c1F |
| InChI | InChI=1S/C21H14Cl2F4N6S/c22-12-2-1-11(15(23)5-12)8-33-9-13(7-28-33)29-21(34)30-18-3-4-32(31-18)10-14-19(26)16(24)6-17(25)20(14)27/h1-7,9H,8,10H2,(H2,29,30,31,34) |
| InChIKey | BKCILMHJOVMFPQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|