C21H16Cl4N6S — CID 19399450
1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19399450) has the molecular formula C21H16Cl4N6S and a molecular weight of 526.28 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19399450 |
| Molecular Formula | C21H16Cl4N6S |
| Molecular Weight | 526.28 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | S=C(Nc1ccn(Cc2ccc(Cl)cc2)n1)Nc1nn(Cc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl4N6S/c22-15-4-1-13(2-5-15)10-30-8-7-19(28-30)26-21(32)27-20-18(25)12-31(29-20)11-14-3-6-16(23)9-17(14)24/h1-9,12H,10-11H2,(H2,26,27,28,29,32) |
| InChIKey | WHBMMJVYCONICH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.28 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|