C18H14Cl4N4S — CID 2211450
1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenyl)methyl]thiourea (PubChem CID 2211450) has the molecular formula C18H14Cl4N4S and a molecular weight of 460.22 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenyl)methyl]thiourea.
| Compound Name | 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 2211450 |
| Molecular Formula | C18H14Cl4N4S |
| Molecular Weight | 460.22 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 1-[4-chloro-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-[(4-chlorophenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(Cl)cc1)Nc1nn(Cc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl4N4S/c19-13-4-1-11(2-5-13)8-23-18(27)24-17-16(22)10-26(25-17)9-12-3-6-14(20)7-15(12)21/h1-7,10H,8-9H2,(H2,23,24,25,27) |
| InChIKey | DUSFDGUSHDKSRJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.22 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|