C23H21ClN6O2S — CID 19344672
methyl 2-[[4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]pyrazol-1-yl]methyl]benzoate (PubChem CID 19344672) has the molecular formula C23H21ClN6O2S and a molecular weight of 480.98 g/mol. Its IUPAC name is methyl 2-[[4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 2-[[4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19344672 |
| Molecular Formula | C23H21ClN6O2S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 2-[[4-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]carbamothioylamino]pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1Cn1cc(NC(=S)Nc2cnn(Cc3ccccc3Cl)c2)cn1 |
| InChI | InChI=1S/C23H21ClN6O2S/c1-32-22(31)20-8-4-2-6-16(20)12-29-14-18(10-25-29)27-23(33)28-19-11-26-30(15-19)13-17-7-3-5-9-21(17)24/h2-11,14-15H,12-13H2,1H3,(H2,27,28,33) |
| InChIKey | HDHLKQJNTKEHEH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|